C27H24F3N5O2 — CID 170341455
1-[3-[2-amino-8-[4-[[4-(trifluoromethyl)-2-pyridinyl]oxy]phenyl]-7H-quinazolin-8-yl]pyrrolidin-1-yl]prop-2-en-1-one (PubChem CID 170341455) has the molecular formula C27H24F3N5O2 and a molecular weight of 507.52 g/mol. Its IUPAC name is 1-[3-[2-amino-8-[4-[[4-(trifluoromethyl)-2-pyridinyl]oxy]phenyl]-7H-quinazolin-8-yl]pyrrolidin-1-yl]prop-2-en-1-one.
| Compound Name | 1-[3-[2-amino-8-[4-[[4-(trifluoromethyl)-2-pyridinyl]oxy]phenyl]-7H-quinazolin-8-yl]pyrrolidin-1-yl]prop-2-en-1-one |
|---|---|
| PubChem CID | 170341455 |
| Molecular Formula | C27H24F3N5O2 |
| Molecular Weight | 507.52 g/mol |
| Exact Mass | 507.19 |
| IUPAC Name | 1-[3-[2-amino-8-[4-[[4-(trifluoromethyl)-2-pyridinyl]oxy]phenyl]-7H-quinazolin-8-yl]pyrrolidin-1-yl]prop-2-en-1-one |
| SMILES | C=CC(=O)N1CCC(C2(c3ccc(Oc4cc(C(F)(F)F)ccn4)cc3)CC=Cc3cnc(N)nc32)C1 |
| InChI | InChI=1S/C27H24F3N5O2/c1-2-23(36)35-13-10-20(16-35)26(11-3-4-17-15-33-25(31)34-24(17)26)18-5-7-21(8-6-18)37-22-14-19(9-12-32-22)27(28,29)30/h2-9,12,14-15,20H,1,10-11,13,16H2,(H2,31,33,34) |
| InChIKey | SLLPZYUEZCCPAH-UHFFFAOYSA-N |
| XLogP | 5.00 |
| TPSA | 94.23 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 37 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 507.52 |
| LogP ≤ 5 | 5.00 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|