C15H24N2O3S2 — CID 17034211
5-ethyl-3-(6-morpholin-4-yl-6-oxohexyl)-2-sulfanylidene-1,3-thiazolidin-4-one (PubChem CID 17034211) has the molecular formula C15H24N2O3S2 and a molecular weight of 344.50 g/mol. Its IUPAC name is 5-ethyl-3-(6-morpholin-4-yl-6-oxohexyl)-2-sulfanylidene-1,3-thiazolidin-4-one.
| Compound Name | 5-ethyl-3-(6-morpholin-4-yl-6-oxohexyl)-2-sulfanylidene-1,3-thiazolidin-4-one |
|---|---|
| PubChem CID | 17034211 |
| Molecular Formula | C15H24N2O3S2 |
| Molecular Weight | 344.50 g/mol |
| Exact Mass | 344.12 |
| IUPAC Name | 5-ethyl-3-(6-morpholin-4-yl-6-oxohexyl)-2-sulfanylidene-1,3-thiazolidin-4-one |
| SMILES | CCC1SC(=S)N(CCCCCC(=O)N2CCOCC2)C1=O |
| InChI | InChI=1S/C15H24N2O3S2/c1-2-12-14(19)17(15(21)22-12)7-5-3-4-6-13(18)16-8-10-20-11-9-16/h12H,2-11H2,1H3 |
| InChIKey | HTXPEJOKNUJGAC-UHFFFAOYSA-N |
| XLogP | 2.04 |
| TPSA | 49.85 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 344.50 |
| LogP ≤ 5 | 2.04 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'rhod_sat_A(33)', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|