C12H16N2O3S2 — CID 18892118
5-(2-morpholin-4-yl-2-oxoethyl)-3-prop-2-enyl-2-sulfanylidene-1,3-thiazolidin-4-one (PubChem CID 18892118) has the molecular formula C12H16N2O3S2 and a molecular weight of 300.41 g/mol. Its IUPAC name is 5-(2-morpholin-4-yl-2-oxoethyl)-3-prop-2-enyl-2-sulfanylidene-1,3-thiazolidin-4-one.
| Compound Name | 5-(2-morpholin-4-yl-2-oxoethyl)-3-prop-2-enyl-2-sulfanylidene-1,3-thiazolidin-4-one |
|---|---|
| PubChem CID | 18892118 |
| Molecular Formula | C12H16N2O3S2 |
| Molecular Weight | 300.41 g/mol |
| Exact Mass | 300.06 |
| IUPAC Name | 5-(2-morpholin-4-yl-2-oxoethyl)-3-prop-2-enyl-2-sulfanylidene-1,3-thiazolidin-4-one |
| SMILES | C=CCN1C(=O)C(CC(=O)N2CCOCC2)SC1=S |
| InChI | InChI=1S/C12H16N2O3S2/c1-2-3-14-11(16)9(19-12(14)18)8-10(15)13-4-6-17-7-5-13/h2,9H,1,3-8H2 |
| InChIKey | ZEBKYRFUSOIPAG-UHFFFAOYSA-N |
| XLogP | 0.65 |
| TPSA | 49.85 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 300.41 |
| LogP ≤ 5 | 0.65 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'rhod_sat_A(33)', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|