C13H16N2O5 — CID 170342607
1-[(1R,2S,3R,3aS,5R)-2,3,5-trihydroxy-2,3,3a,4,5,6-hexahydro-1H-inden-1-yl]pyrimidine-2,4-dione (PubChem CID 170342607) has the molecular formula C13H16N2O5 and a molecular weight of 280.28 g/mol. Its IUPAC name is 1-[(1R,2S,3R,3aS,5R)-2,3,5-trihydroxy-2,3,3a,4,5,6-hexahydro-1H-inden-1-yl]pyrimidine-2,4-dione.
| Compound Name | 1-[(1R,2S,3R,3aS,5R)-2,3,5-trihydroxy-2,3,3a,4,5,6-hexahydro-1H-inden-1-yl]pyrimidine-2,4-dione |
|---|---|
| PubChem CID | 170342607 |
| Molecular Formula | C13H16N2O5 |
| Molecular Weight | 280.28 g/mol |
| Exact Mass | 280.11 |
| IUPAC Name | 1-[(1R,2S,3R,3aS,5R)-2,3,5-trihydroxy-2,3,3a,4,5,6-hexahydro-1H-inden-1-yl]pyrimidine-2,4-dione |
| SMILES | O=c1ccn([C@@H]2C3=CC[C@@H](O)C[C@@H]3[C@@H](O)[C@H]2O)c(=O)[nH]1 |
| InChI | InChI=1S/C13H16N2O5/c16-6-1-2-7-8(5-6)11(18)12(19)10(7)15-4-3-9(17)14-13(15)20/h2-4,6,8,10-12,16,18-19H,1,5H2,(H,14,17,20)/t6-,8+,10-,11-,12+/m1/s1 |
| InChIKey | CYRSCRVSAMKBBH-MMMVTZFJSA-N |
| XLogP | -1.49 |
| TPSA | 115.55 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 280.28 |
| LogP ≤ 5 | -1.49 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|