C17H22N2O6 — CID 170342594
[1-(2,4-dioxopyrimidin-1-yl)-2,3-dihydroxy-2,3,3a,4,5,6-hexahydro-1H-inden-5-yl] 2-methylpropanoate (PubChem CID 170342594) has the molecular formula C17H22N2O6 and a molecular weight of 350.37 g/mol. Its IUPAC name is [1-(2,4-dioxopyrimidin-1-yl)-2,3-dihydroxy-2,3,3a,4,5,6-hexahydro-1H-inden-5-yl] 2-methylpropanoate.
| Compound Name | [1-(2,4-dioxopyrimidin-1-yl)-2,3-dihydroxy-2,3,3a,4,5,6-hexahydro-1H-inden-5-yl] 2-methylpropanoate |
|---|---|
| PubChem CID | 170342594 |
| Molecular Formula | C17H22N2O6 |
| Molecular Weight | 350.37 g/mol |
| Exact Mass | 350.15 |
| IUPAC Name | [1-(2,4-dioxopyrimidin-1-yl)-2,3-dihydroxy-2,3,3a,4,5,6-hexahydro-1H-inden-5-yl] 2-methylpropanoate |
| SMILES | CC(C)C(=O)OC1CC=C2C(C1)C(O)C(O)C2n1ccc(=O)[nH]c1=O |
| InChI | InChI=1S/C17H22N2O6/c1-8(2)16(23)25-9-3-4-10-11(7-9)14(21)15(22)13(10)19-6-5-12(20)18-17(19)24/h4-6,8-9,11,13-15,21-22H,3,7H2,1-2H3,(H,18,20,24) |
| InChIKey | YQFHSWPBPJGZFS-UHFFFAOYSA-N |
| XLogP | -0.28 |
| TPSA | 121.62 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 350.37 |
| LogP ≤ 5 | -0.28 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|