C13H16N2O4 — CID 40596145
ethyl (4S)-4-(2,4-dioxopyrimidin-1-yl)cyclohexene-1-carboxylate (PubChem CID 40596145) has the molecular formula C13H16N2O4 and a molecular weight of 264.28 g/mol. Its IUPAC name is ethyl (4S)-4-(2,4-dioxopyrimidin-1-yl)cyclohexene-1-carboxylate.
| Compound Name | ethyl (4S)-4-(2,4-dioxopyrimidin-1-yl)cyclohexene-1-carboxylate |
|---|---|
| PubChem CID | 40596145 |
| Molecular Formula | C13H16N2O4 |
| Molecular Weight | 264.28 g/mol |
| Exact Mass | 264.11 |
| IUPAC Name | ethyl (4S)-4-(2,4-dioxopyrimidin-1-yl)cyclohexene-1-carboxylate |
| SMILES | CCOC(=O)C1=CC[C@@H](n2ccc(=O)[nH]c2=O)CC1 |
| InChI | InChI=1S/C13H16N2O4/c1-2-19-12(17)9-3-5-10(6-4-9)15-8-7-11(16)14-13(15)18/h3,7-8,10H,2,4-6H2,1H3,(H,14,16,18)/t10-/m1/s1 |
| InChIKey | YXWJJAKUJBSOQB-SNVBAGLBSA-N |
| XLogP | 0.75 |
| TPSA | 81.16 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 264.28 |
| LogP ≤ 5 | 0.75 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |