C30H28N2O3 — CID 10528117
1-[4-(trityloxymethyl)cyclohex-3-en-1-yl]pyrimidine-2,4-dione (PubChem CID 10528117) has the molecular formula C30H28N2O3 and a molecular weight of 464.57 g/mol. Its IUPAC name is 1-[4-(trityloxymethyl)cyclohex-3-en-1-yl]pyrimidine-2,4-dione.
| Compound Name | 1-[4-(trityloxymethyl)cyclohex-3-en-1-yl]pyrimidine-2,4-dione |
|---|---|
| PubChem CID | 10528117 |
| Molecular Formula | C30H28N2O3 |
| Molecular Weight | 464.57 g/mol |
| Exact Mass | 464.21 |
| IUPAC Name | 1-[4-(trityloxymethyl)cyclohex-3-en-1-yl]pyrimidine-2,4-dione |
| SMILES | O=c1ccn(C2CC=C(COC(c3ccccc3)(c3ccccc3)c3ccccc3)CC2)c(=O)[nH]1 |
| InChI | InChI=1S/C30H28N2O3/c33-28-20-21-32(29(34)31-28)27-18-16-23(17-19-27)22-35-30(24-10-4-1-5-11-24,25-12-6-2-7-13-25)26-14-8-3-9-15-26/h1-16,20-21,27H,17-19,22H2,(H,31,33,34) |
| InChIKey | YSYFPIKEVWIVGQ-UHFFFAOYSA-N |
| XLogP | 5.20 |
| TPSA | 64.09 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 35 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 464.57 |
| LogP ≤ 5 | 5.20 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'triphenyl_methyl-silyl', 'substructure': 'N/A'} |
|---|