C33H34N2O6 — CID 124581828
1-[(2R,3R,5S)-3-[(2S)-oxan-2-yl]oxy-5-(trityloxymethyl)oxolan-2-yl]pyrimidine-2,4-dione (PubChem CID 124581828) has the molecular formula C33H34N2O6 and a molecular weight of 554.64 g/mol. Its IUPAC name is 1-[(2R,3R,5S)-3-[(2S)-oxan-2-yl]oxy-5-(trityloxymethyl)oxolan-2-yl]pyrimidine-2,4-dione.
| Compound Name | 1-[(2R,3R,5S)-3-[(2S)-oxan-2-yl]oxy-5-(trityloxymethyl)oxolan-2-yl]pyrimidine-2,4-dione |
|---|---|
| PubChem CID | 124581828 |
| Molecular Formula | C33H34N2O6 |
| Molecular Weight | 554.64 g/mol |
| Exact Mass | 554.24 |
| IUPAC Name | 1-[(2R,3R,5S)-3-[(2S)-oxan-2-yl]oxy-5-(trityloxymethyl)oxolan-2-yl]pyrimidine-2,4-dione |
| SMILES | O=c1ccn([C@@H]2O[C@H](COC(c3ccccc3)(c3ccccc3)c3ccccc3)C[C@H]2O[C@H]2CCCCO2)c(=O)[nH]1 |
| InChI | InChI=1S/C33H34N2O6/c36-29-19-20-35(32(37)34-29)31-28(41-30-18-10-11-21-38-30)22-27(40-31)23-39-33(24-12-4-1-5-13-24,25-14-6-2-7-15-25)26-16-8-3-9-17-26/h1-9,12-17,19-20,27-28,30-31H,10-11,18,21-23H2,(H,34,36,37)/t27-,28+,30-,31+/m0/s1 |
| InChIKey | GSKCTTJZWPCGDZ-MAJIKDHASA-N |
| XLogP | 4.74 |
| TPSA | 91.78 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 41 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 554.64 |
| LogP ≤ 5 | 4.74 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'triphenyl_methyl-silyl', 'substructure': 'N/A'} |
|---|