C36H35N3O9 — CID 101369933
1-[(2R,3R,5S)-5-[[bis(4-methoxyphenyl)-phenylmethoxy]methyl]-3-[(2-ethoxy-3,4-dioxocyclobuten-1-yl)amino]oxolan-2-yl]pyrimidine-2,4-dione (PubChem CID 101369933) has the molecular formula C36H35N3O9 and a molecular weight of 653.69 g/mol. Its IUPAC name is 1-[(2R,3R,5S)-5-[[bis(4-methoxyphenyl)-phenylmethoxy]methyl]-3-[(2-ethoxy-3,4-dioxocyclobuten-1-yl)amino]oxolan-2-yl]pyrimidine-2,4-dione.
| Compound Name | 1-[(2R,3R,5S)-5-[[bis(4-methoxyphenyl)-phenylmethoxy]methyl]-3-[(2-ethoxy-3,4-dioxocyclobuten-1-yl)amino]oxolan-2-yl]pyrimidine-2,4-dione |
|---|---|
| PubChem CID | 101369933 |
| Molecular Formula | C36H35N3O9 |
| Molecular Weight | 653.69 g/mol |
| Exact Mass | 653.24 |
| IUPAC Name | 1-[(2R,3R,5S)-5-[[bis(4-methoxyphenyl)-phenylmethoxy]methyl]-3-[(2-ethoxy-3,4-dioxocyclobuten-1-yl)amino]oxolan-2-yl]pyrimidine-2,4-dione |
| SMILES | CCOc1c(N[C@@H]2C[C@@H](COC(c3ccccc3)(c3ccc(OC)cc3)c3ccc(OC)cc3)O[C@H]2n2ccc(=O)[nH]c2=O)c(=O)c1=O |
| InChI | InChI=1S/C36H35N3O9/c1-4-46-33-30(31(41)32(33)42)37-28-20-27(48-34(28)39-19-18-29(40)38-35(39)43)21-47-36(22-8-6-5-7-9-22,23-10-14-25(44-2)15-11-23)24-12-16-26(45-3)17-13-24/h5-19,27-28,34,37H,4,20-21H2,1-3H3,(H,38,40,43)/t27-,28+,34+/m0/s1 |
| InChIKey | YFMROAQVUUPVNW-HBVNVMGMSA-N |
| XLogP | 3.33 |
| TPSA | 147.18 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 11 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 48 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 653.69 |
| LogP ≤ 5 | 3.33 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 11 |
| Structural Alerts | {'alert_name': 'diketo_group', 'substructure': 'N/A'}, {'alert_name': 'triphenyl_methyl-silyl', 'substructure': 'N/A'} |
|---|