C25H30FN2O7PS — CID 170343449
(1R,6S)-6-[[3-ethoxy-4-[[3-(1-fluoro-1-phosphanylethoxy)-4-methylphenyl]sulfamoyl]phenyl]carbamoyl]cyclohex-3-ene-1-carboxylic acid (PubChem CID 170343449) has the molecular formula C25H30FN2O7PS and a molecular weight of 552.56 g/mol. Its IUPAC name is (1R,6S)-6-[[3-ethoxy-4-[[3-(1-fluoro-1-phosphanylethoxy)-4-methylphenyl]sulfamoyl]phenyl]carbamoyl]cyclohex-3-ene-1-carboxylic acid.
| Compound Name | (1R,6S)-6-[[3-ethoxy-4-[[3-(1-fluoro-1-phosphanylethoxy)-4-methylphenyl]sulfamoyl]phenyl]carbamoyl]cyclohex-3-ene-1-carboxylic acid |
|---|---|
| PubChem CID | 170343449 |
| Molecular Formula | C25H30FN2O7PS |
| Molecular Weight | 552.56 g/mol |
| Exact Mass | 552.15 |
| IUPAC Name | (1R,6S)-6-[[3-ethoxy-4-[[3-(1-fluoro-1-phosphanylethoxy)-4-methylphenyl]sulfamoyl]phenyl]carbamoyl]cyclohex-3-ene-1-carboxylic acid |
| SMILES | CCOc1cc(NC(=O)[C@H]2CC=CC[C@H]2C(=O)O)ccc1S(=O)(=O)Nc1ccc(C)c(OC(C)(F)P)c1 |
| InChI | InChI=1S/C25H30FN2O7PS/c1-4-34-21-13-16(27-23(29)18-7-5-6-8-19(18)24(30)31)11-12-22(21)37(32,33)28-17-10-9-15(2)20(14-17)35-25(3,26)36/h5-6,9-14,18-19,28H,4,7-8,36H2,1-3H3,(H,27,29)(H,30,31)/t18-,19+,25?/m0/s1 |
| InChIKey | DRLOYBPCFMYRFU-HPLQXTBUSA-N |
| XLogP | 4.70 |
| TPSA | 131.03 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 37 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 552.56 |
| LogP ≤ 5 | 4.70 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|