C7H13NO6S — CID 170344357
(3S)-3-(methylsulfonyloxymethyl)morpholine-4-carboxylic acid (PubChem CID 170344357) has the molecular formula C7H13NO6S and a molecular weight of 239.25 g/mol. Its IUPAC name is (3S)-3-(methylsulfonyloxymethyl)morpholine-4-carboxylic acid.
| Compound Name | (3S)-3-(methylsulfonyloxymethyl)morpholine-4-carboxylic acid |
|---|---|
| PubChem CID | 170344357 |
| Molecular Formula | C7H13NO6S |
| Molecular Weight | 239.25 g/mol |
| Exact Mass | 239.05 |
| IUPAC Name | (3S)-3-(methylsulfonyloxymethyl)morpholine-4-carboxylic acid |
| SMILES | CS(=O)(=O)OC[C@@H]1COCCN1C(=O)O |
| InChI | InChI=1S/C7H13NO6S/c1-15(11,12)14-5-6-4-13-3-2-8(6)7(9)10/h6H,2-5H2,1H3,(H,9,10)/t6-/m0/s1 |
| InChIKey | AHJZCTALLVCCJZ-LURJTMIESA-N |
| XLogP | -0.66 |
| TPSA | 93.14 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 239.25 |
| LogP ≤ 5 | -0.66 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Sulfonic_acid_1', 'substructure': 'N/A'} |
|---|