C12H13ClN2O6 — CID 141152542
(3R)-3-[(4-chloro-2-nitrophenoxy)methyl]morpholine-4-carboxylic acid (PubChem CID 141152542) has the molecular formula C12H13ClN2O6 and a molecular weight of 316.70 g/mol. Its IUPAC name is (3R)-3-[(4-chloro-2-nitrophenoxy)methyl]morpholine-4-carboxylic acid.
| Compound Name | (3R)-3-[(4-chloro-2-nitrophenoxy)methyl]morpholine-4-carboxylic acid |
|---|---|
| PubChem CID | 141152542 |
| Molecular Formula | C12H13ClN2O6 |
| Molecular Weight | 316.70 g/mol |
| Exact Mass | 316.05 |
| IUPAC Name | (3R)-3-[(4-chloro-2-nitrophenoxy)methyl]morpholine-4-carboxylic acid |
| SMILES | O=C(O)N1CCOC[C@@H]1COc1ccc(Cl)cc1[N+](=O)[O-] |
| InChI | InChI=1S/C12H13ClN2O6/c13-8-1-2-11(10(5-8)15(18)19)21-7-9-6-20-4-3-14(9)12(16)17/h1-2,5,9H,3-4,6-7H2,(H,16,17)/t9-/m1/s1 |
| InChIKey | VDARCRYTNZJOLV-SECBINFHSA-N |
| XLogP | 2.01 |
| TPSA | 102.14 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 316.70 |
| LogP ≤ 5 | 2.01 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|