C17H20N4O3 — CID 170346650
5-amino-6-(5-hydroxy-2-methylphenyl)-2-(oxan-4-yl)pyrimidine-4-carboxamide (PubChem CID 170346650) has the molecular formula C17H20N4O3 and a molecular weight of 328.37 g/mol. Its IUPAC name is 5-amino-6-(5-hydroxy-2-methylphenyl)-2-(oxan-4-yl)pyrimidine-4-carboxamide.
| Compound Name | 5-amino-6-(5-hydroxy-2-methylphenyl)-2-(oxan-4-yl)pyrimidine-4-carboxamide |
|---|---|
| PubChem CID | 170346650 |
| Molecular Formula | C17H20N4O3 |
| Molecular Weight | 328.37 g/mol |
| Exact Mass | 328.15 |
| IUPAC Name | 5-amino-6-(5-hydroxy-2-methylphenyl)-2-(oxan-4-yl)pyrimidine-4-carboxamide |
| SMILES | Cc1ccc(O)cc1-c1nc(C2CCOCC2)nc(C(N)=O)c1N |
| InChI | InChI=1S/C17H20N4O3/c1-9-2-3-11(22)8-12(9)14-13(18)15(16(19)23)21-17(20-14)10-4-6-24-7-5-10/h2-3,8,10,22H,4-7,18H2,1H3,(H2,19,23) |
| InChIKey | RIBZIGLBGFVTNH-UHFFFAOYSA-N |
| XLogP | 1.73 |
| TPSA | 124.35 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 328.37 |
| LogP ≤ 5 | 1.73 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |