C22H21F3N3O6S+ — CID 170347072
N-[3-ethoxy-4-[[3-(trifluoromethoxy)phenyl]sulfamoyl]phenyl]-1-methoxypyridin-1-ium-3-carboxamide (PubChem CID 170347072) has the molecular formula C22H21F3N3O6S+ and a molecular weight of 512.49 g/mol. Its IUPAC name is N-[3-ethoxy-4-[[3-(trifluoromethoxy)phenyl]sulfamoyl]phenyl]-1-methoxypyridin-1-ium-3-carboxamide.
| Compound Name | N-[3-ethoxy-4-[[3-(trifluoromethoxy)phenyl]sulfamoyl]phenyl]-1-methoxypyridin-1-ium-3-carboxamide |
|---|---|
| PubChem CID | 170347072 |
| Molecular Formula | C22H21F3N3O6S+ |
| Molecular Weight | 512.49 g/mol |
| Exact Mass | 512.11 |
| IUPAC Name | N-[3-ethoxy-4-[[3-(trifluoromethoxy)phenyl]sulfamoyl]phenyl]-1-methoxypyridin-1-ium-3-carboxamide |
| SMILES | CCOc1cc(NC(=O)c2ccc[n+](OC)c2)ccc1S(=O)(=O)Nc1cccc(OC(F)(F)F)c1 |
| InChI | InChI=1S/C22H20F3N3O6S/c1-3-33-19-13-16(26-21(29)15-6-5-11-28(14-15)32-2)9-10-20(19)35(30,31)27-17-7-4-8-18(12-17)34-22(23,24)25/h4-14,27H,3H2,1-2H3/p+1 |
| InChIKey | GJMBKLGBZZUYSA-UHFFFAOYSA-O |
| XLogP | 3.38 |
| TPSA | 106.84 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 35 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 512.49 |
| LogP ≤ 5 | 3.38 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|