methyl 4-pentadecan-8-ylpiperazine-1-carboxylate

C21H42N2O2 — CID 170347075

IUPACmethyl 4-pentadecan-8-ylpiperazine-1-carboxylate
SMILESCCCCCCCC(CCCCCCC)N1CCN(C(=O)OC)CC1
InChIInChI=1S/C21H42N2O2/c1-4-6-8-10-12-14-20(15-13-11-9-7-5-2)22-16-18-23(19-17-22)21(24)25-3/h20H,4-19H2,1-3H3
InChIKeyYMHUSQLNUNIZQU-UHFFFAOYSA-N
MW354.58 g/mol
LogP5.46
Rot. Bonds13

About methyl 4-pentadecan-8-ylpiperazine-1-carboxylate

methyl 4-pentadecan-8-ylpiperazine-1-carboxylate (PubChem CID 170347075) has the molecular formula C21H42N2O2 and a molecular weight of 354.58 g/mol. Its IUPAC name is methyl 4-pentadecan-8-ylpiperazine-1-carboxylate.

Molecular Properties

Compound Namemethyl 4-pentadecan-8-ylpiperazine-1-carboxylate
PubChem CID170347075
Molecular FormulaC21H42N2O2
Molecular Weight354.58 g/mol
Exact Mass354.32
IUPAC Namemethyl 4-pentadecan-8-ylpiperazine-1-carboxylate
SMILESCCCCCCCC(CCCCCCC)N1CCN(C(=O)OC)CC1
InChIInChI=1S/C21H42N2O2/c1-4-6-8-10-12-14-20(15-13-11-9-7-5-2)22-16-18-23(19-17-22)21(24)25-3/h20H,4-19H2,1-3H3
InChIKeyYMHUSQLNUNIZQU-UHFFFAOYSA-N
XLogP5.46
TPSA32.78 Ų
H-Bond Donors
H-Bond Acceptors3
Rotatable Bonds13
Heavy Atoms25
Complexity—

Lipinski Rule of Five

1 violation

RuleValue
MW ≤ 500354.58
LogP ≤ 55.46
H-Bond Donors ≤ 50
H-Bond Acceptors ≤ 103

Computed Properties (RDKit)

Structural Alerts{'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}

Analyze methyl 4-pentadecan-8-ylpiperazine-1-carboxylate with MolForge

Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.

Launch Full Analysis

Frequently Asked Questions

What is the IUPAC name of methyl 4-pentadecan-8-ylpiperazine-1-carboxylate?
The IUPAC name of methyl 4-pentadecan-8-ylpiperazine-1-carboxylate (CID 170347075) is methyl 4-pentadecan-8-ylpiperazine-1-carboxylate.
What is the SMILES notation for methyl 4-pentadecan-8-ylpiperazine-1-carboxylate?
The canonical SMILES for methyl 4-pentadecan-8-ylpiperazine-1-carboxylate is CCCCCCCC(CCCCCCC)N1CCN(C(=O)OC)CC1.
What is the InChIKey of methyl 4-pentadecan-8-ylpiperazine-1-carboxylate?
The InChIKey is YMHUSQLNUNIZQU-UHFFFAOYSA-N. The full InChI is InChI=1S/C21H42N2O2/c1-4-6-8-10-12-14-20(15-13-11-9-7-5-2)22-16-18-23(19-17-22)21(24)25-3/h20H,4-19H2,1-3H3.
What are the key properties of methyl 4-pentadecan-8-ylpiperazine-1-carboxylate?
methyl 4-pentadecan-8-ylpiperazine-1-carboxylate has a molecular weight of 354.58 g/mol, XLogP of 5.46, 13 rotatable bonds, 0 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for methyl 4-pentadecan-8-ylpiperazine-1-carboxylate is sourced from PubChem (CID 170347075), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).