C20H21F2NO2 — CID 170347160
ethyl 2-(benzhydrylideneamino)-4,4-difluoro-2-methylbutanoate (PubChem CID 170347160) has the molecular formula C20H21F2NO2 and a molecular weight of 345.39 g/mol. Its IUPAC name is ethyl 2-(benzhydrylideneamino)-4,4-difluoro-2-methylbutanoate.
| Compound Name | ethyl 2-(benzhydrylideneamino)-4,4-difluoro-2-methylbutanoate |
|---|---|
| PubChem CID | 170347160 |
| Molecular Formula | C20H21F2NO2 |
| Molecular Weight | 345.39 g/mol |
| Exact Mass | 345.15 |
| IUPAC Name | ethyl 2-(benzhydrylideneamino)-4,4-difluoro-2-methylbutanoate |
| SMILES | CCOC(=O)C(C)(CC(F)F)N=C(c1ccccc1)c1ccccc1 |
| InChI | InChI=1S/C20H21F2NO2/c1-3-25-19(24)20(2,14-17(21)22)23-18(15-10-6-4-7-11-15)16-12-8-5-9-13-16/h4-13,17H,3,14H2,1-2H3 |
| InChIKey | BAERBLRUUFHVET-UHFFFAOYSA-N |
| XLogP | 4.50 |
| TPSA | 38.66 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 345.39 |
| LogP ≤ 5 | 4.50 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|