C13H13F2N5O6S — CID 170348577
[(2S,5R)-2-[N-(5,6-difluoropyridine-2-carbonyl)carbamimidoyl]-7-oxo-1,6-diazabicyclo[3.2.1]octan-6-yl] hydrogen sulfate (PubChem CID 170348577) has the molecular formula C13H13F2N5O6S and a molecular weight of 405.34 g/mol. Its IUPAC name is [(2S,5R)-2-[N-(5,6-difluoropyridine-2-carbonyl)carbamimidoyl]-7-oxo-1,6-diazabicyclo[3.2.1]octan-6-yl] hydrogen sulfate.
| Compound Name | [(2S,5R)-2-[N-(5,6-difluoropyridine-2-carbonyl)carbamimidoyl]-7-oxo-1,6-diazabicyclo[3.2.1]octan-6-yl] hydrogen sulfate |
|---|---|
| PubChem CID | 170348577 |
| Molecular Formula | C13H13F2N5O6S |
| Molecular Weight | 405.34 g/mol |
| Exact Mass | 405.06 |
| IUPAC Name | [(2S,5R)-2-[N-(5,6-difluoropyridine-2-carbonyl)carbamimidoyl]-7-oxo-1,6-diazabicyclo[3.2.1]octan-6-yl] hydrogen sulfate |
| SMILES | [H]/N=C(\NC(=O)c1ccc(F)c(F)n1)[C@@H]1CC[C@@H]2CN1C(=O)N2OS(=O)(=O)O |
| InChI | InChI=1S/C13H13F2N5O6S/c14-7-2-3-8(17-10(7)15)12(21)18-11(16)9-4-1-6-5-19(9)13(22)20(6)26-27(23,24)25/h2-3,6,9H,1,4-5H2,(H2,16,18,21)(H,23,24,25)/t6-,9+/m1/s1 |
| InChIKey | YGZRURMJHIAYNC-MUWHJKNJSA-N |
| XLogP | 0.07 |
| TPSA | 152.99 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 405.34 |
| LogP ≤ 5 | 0.07 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': '2-halo_pyridine', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'} |
|---|