C21H23N5O — CID 170352416
3-[amino-[(Z)-1-amino-3-(4-phenylmethoxyphenyl)prop-1-en-2-yl]amino]pyridin-2-amine (PubChem CID 170352416) has the molecular formula C21H23N5O and a molecular weight of 361.45 g/mol. Its IUPAC name is 3-[amino-[(Z)-1-amino-3-(4-phenylmethoxyphenyl)prop-1-en-2-yl]amino]pyridin-2-amine.
| Compound Name | 3-[amino-[(Z)-1-amino-3-(4-phenylmethoxyphenyl)prop-1-en-2-yl]amino]pyridin-2-amine |
|---|---|
| PubChem CID | 170352416 |
| Molecular Formula | C21H23N5O |
| Molecular Weight | 361.45 g/mol |
| Exact Mass | 361.19 |
| IUPAC Name | 3-[amino-[(Z)-1-amino-3-(4-phenylmethoxyphenyl)prop-1-en-2-yl]amino]pyridin-2-amine |
| SMILES | N/C=C(/Cc1ccc(OCc2ccccc2)cc1)N(N)c1cccnc1N |
| InChI | InChI=1S/C21H23N5O/c22-14-18(26(24)20-7-4-12-25-21(20)23)13-16-8-10-19(11-9-16)27-15-17-5-2-1-3-6-17/h1-12,14H,13,15,22,24H2,(H2,23,25)/b18-14- |
| InChIKey | GMLPURZMIMTZLT-JXAWBTAJSA-N |
| XLogP | 2.97 |
| TPSA | 103.42 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 361.45 |
| LogP ≤ 5 | 2.97 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'hydrazine', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|