C13H16ClN3 — CID 170352618
4-chloro-2-(piperidin-2-ylmethyl)-1H-pyrrolo[2,3-b]pyridine (PubChem CID 170352618) has the molecular formula C13H16ClN3 and a molecular weight of 249.74 g/mol. Its IUPAC name is 4-chloro-2-(piperidin-2-ylmethyl)-1H-pyrrolo[2,3-b]pyridine.
| Compound Name | 4-chloro-2-(piperidin-2-ylmethyl)-1H-pyrrolo[2,3-b]pyridine |
|---|---|
| PubChem CID | 170352618 |
| Molecular Formula | C13H16ClN3 |
| Molecular Weight | 249.74 g/mol |
| Exact Mass | 249.10 |
| IUPAC Name | 4-chloro-2-(piperidin-2-ylmethyl)-1H-pyrrolo[2,3-b]pyridine |
| SMILES | Clc1ccnc2[nH]c(CC3CCCCN3)cc12 |
| InChI | InChI=1S/C13H16ClN3/c14-12-4-6-16-13-11(12)8-10(17-13)7-9-3-1-2-5-15-9/h4,6,8-9,15H,1-3,5,7H2,(H,16,17) |
| InChIKey | GOUSOBAJRRAUJC-UHFFFAOYSA-N |
| XLogP | 2.90 |
| TPSA | 40.71 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 249.74 |
| LogP ≤ 5 | 2.90 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |