C18H15BrClN3O4S — CID 170354306
methyl 2-[5-bromo-2-[[1-(4-chlorophenyl)pyrazol-4-yl]sulfonylamino]phenyl]acetate (PubChem CID 170354306) has the molecular formula C18H15BrClN3O4S and a molecular weight of 484.76 g/mol. Its IUPAC name is methyl 2-[5-bromo-2-[[1-(4-chlorophenyl)pyrazol-4-yl]sulfonylamino]phenyl]acetate.
| Compound Name | methyl 2-[5-bromo-2-[[1-(4-chlorophenyl)pyrazol-4-yl]sulfonylamino]phenyl]acetate |
|---|---|
| PubChem CID | 170354306 |
| Molecular Formula | C18H15BrClN3O4S |
| Molecular Weight | 484.76 g/mol |
| Exact Mass | 482.97 |
| IUPAC Name | methyl 2-[5-bromo-2-[[1-(4-chlorophenyl)pyrazol-4-yl]sulfonylamino]phenyl]acetate |
| SMILES | COC(=O)Cc1cc(Br)ccc1NS(=O)(=O)c1cnn(-c2ccc(Cl)cc2)c1 |
| InChI | InChI=1S/C18H15BrClN3O4S/c1-27-18(24)9-12-8-13(19)2-7-17(12)22-28(25,26)16-10-21-23(11-16)15-5-3-14(20)4-6-15/h2-8,10-11,22H,9H2,1H3 |
| InChIKey | QGUPRVVFDGTPRL-UHFFFAOYSA-N |
| XLogP | 3.80 |
| TPSA | 90.29 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 484.76 |
| LogP ≤ 5 | 3.80 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |