C18H18F3NO3S — CID 170354979
[(2S,6R)-2,6-dimethylmorpholin-4-yl]-[5-(2,4,5-trifluoro-3-methoxyphenyl)thiophen-2-yl]methanone (PubChem CID 170354979) has the molecular formula C18H18F3NO3S and a molecular weight of 385.41 g/mol. Its IUPAC name is [(2S,6R)-2,6-dimethylmorpholin-4-yl]-[5-(2,4,5-trifluoro-3-methoxyphenyl)thiophen-2-yl]methanone.
| Compound Name | [(2S,6R)-2,6-dimethylmorpholin-4-yl]-[5-(2,4,5-trifluoro-3-methoxyphenyl)thiophen-2-yl]methanone |
|---|---|
| PubChem CID | 170354979 |
| Molecular Formula | C18H18F3NO3S |
| Molecular Weight | 385.41 g/mol |
| Exact Mass | 385.10 |
| IUPAC Name | [(2S,6R)-2,6-dimethylmorpholin-4-yl]-[5-(2,4,5-trifluoro-3-methoxyphenyl)thiophen-2-yl]methanone |
| SMILES | COc1c(F)c(F)cc(-c2ccc(C(=O)N3C[C@@H](C)O[C@@H](C)C3)s2)c1F |
| InChI | InChI=1S/C18H18F3NO3S/c1-9-7-22(8-10(2)25-9)18(23)14-5-4-13(26-14)11-6-12(19)16(21)17(24-3)15(11)20/h4-6,9-10H,7-8H2,1-3H3/t9-,10+ |
| InChIKey | CABWIKKPTCCAJZ-AOOOYVTPSA-N |
| XLogP | 4.09 |
| TPSA | 38.77 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 385.41 |
| LogP ≤ 5 | 4.09 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'halogenated_ring_1', 'substructure': 'N/A'} |
|---|