C15H14F3N3O4 — CID 170355027
[(2R,6S)-2,6-dimethylmorpholin-4-yl]-[3-(2,4,5-trifluoro-3-hydroxyphenyl)-1,2,4-oxadiazol-5-yl]methanone (PubChem CID 170355027) has the molecular formula C15H14F3N3O4 and a molecular weight of 357.29 g/mol. Its IUPAC name is [(2R,6S)-2,6-dimethylmorpholin-4-yl]-[3-(2,4,5-trifluoro-3-hydroxyphenyl)-1,2,4-oxadiazol-5-yl]methanone.
| Compound Name | [(2R,6S)-2,6-dimethylmorpholin-4-yl]-[3-(2,4,5-trifluoro-3-hydroxyphenyl)-1,2,4-oxadiazol-5-yl]methanone |
|---|---|
| PubChem CID | 170355027 |
| Molecular Formula | C15H14F3N3O4 |
| Molecular Weight | 357.29 g/mol |
| Exact Mass | 357.09 |
| IUPAC Name | [(2R,6S)-2,6-dimethylmorpholin-4-yl]-[3-(2,4,5-trifluoro-3-hydroxyphenyl)-1,2,4-oxadiazol-5-yl]methanone |
| SMILES | C[C@@H]1CN(C(=O)c2nc(-c3cc(F)c(F)c(O)c3F)no2)C[C@H](C)O1 |
| InChI | InChI=1S/C15H14F3N3O4/c1-6-4-21(5-7(2)24-6)15(23)14-19-13(20-25-14)8-3-9(16)11(18)12(22)10(8)17/h3,6-7,22H,4-5H2,1-2H3/t6-,7+ |
| InChIKey | WIXFOQKLJXMDJL-KNVOCYPGSA-N |
| XLogP | 2.11 |
| TPSA | 88.69 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 357.29 |
| LogP ≤ 5 | 2.11 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'halogenated_ring_1', 'substructure': 'N/A'} |
|---|