C15H12F3NO2S — CID 170590797
pyrrolidin-1-yl-[5-(2,4,5-trifluoro-3-hydroxyphenyl)thiophen-2-yl]methanone (PubChem CID 170590797) has the molecular formula C15H12F3NO2S and a molecular weight of 327.33 g/mol. Its IUPAC name is pyrrolidin-1-yl-[5-(2,4,5-trifluoro-3-hydroxyphenyl)thiophen-2-yl]methanone.
| Compound Name | pyrrolidin-1-yl-[5-(2,4,5-trifluoro-3-hydroxyphenyl)thiophen-2-yl]methanone |
|---|---|
| PubChem CID | 170590797 |
| Molecular Formula | C15H12F3NO2S |
| Molecular Weight | 327.33 g/mol |
| Exact Mass | 327.05 |
| IUPAC Name | pyrrolidin-1-yl-[5-(2,4,5-trifluoro-3-hydroxyphenyl)thiophen-2-yl]methanone |
| SMILES | O=C(c1ccc(-c2cc(F)c(F)c(O)c2F)s1)N1CCCC1 |
| InChI | InChI=1S/C15H12F3NO2S/c16-9-7-8(12(17)14(20)13(9)18)10-3-4-11(22-10)15(21)19-5-1-2-6-19/h3-4,7,20H,1-2,5-6H2 |
| InChIKey | QGMGQXILNXLQMY-UHFFFAOYSA-N |
| XLogP | 3.77 |
| TPSA | 40.54 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 327.33 |
| LogP ≤ 5 | 3.77 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'halogenated_ring_1', 'substructure': 'N/A'} |
|---|