C33H44N4O7 — CID 170355846
3-benzyl-6-[(4-hydroxyphenyl)methyl]-8-[(2S)-1-(4-methylpentylamino)-1-oxohexan-2-yl]-4,7-dioxo-9,9a-dihydro-6H-pyrazino[2,1-c][1,2,4]oxadiazine-1-carboxylic acid (PubChem CID 170355846) has the molecular formula C33H44N4O7 and a molecular weight of 608.74 g/mol. Its IUPAC name is 3-benzyl-6-[(4-hydroxyphenyl)methyl]-8-[(2S)-1-(4-methylpentylamino)-1-oxohexan-2-yl]-4,7-dioxo-9,9a-dihydro-6H-pyrazino[2,1-c][1,2,4]oxadiazine-1-carboxylic acid.
| Compound Name | 3-benzyl-6-[(4-hydroxyphenyl)methyl]-8-[(2S)-1-(4-methylpentylamino)-1-oxohexan-2-yl]-4,7-dioxo-9,9a-dihydro-6H-pyrazino[2,1-c][1,2,4]oxadiazine-1-carboxylic acid |
|---|---|
| PubChem CID | 170355846 |
| Molecular Formula | C33H44N4O7 |
| Molecular Weight | 608.74 g/mol |
| Exact Mass | 608.32 |
| IUPAC Name | 3-benzyl-6-[(4-hydroxyphenyl)methyl]-8-[(2S)-1-(4-methylpentylamino)-1-oxohexan-2-yl]-4,7-dioxo-9,9a-dihydro-6H-pyrazino[2,1-c][1,2,4]oxadiazine-1-carboxylic acid |
| SMILES | CCCC[C@@H](C(=O)NCCCC(C)C)N1CC2N(C(=O)O)OC(Cc3ccccc3)C(=O)N2C(Cc2ccc(O)cc2)C1=O |
| InChI | InChI=1S/C33H44N4O7/c1-4-5-13-26(30(39)34-18-9-10-22(2)3)35-21-29-36(27(31(35)40)19-24-14-16-25(38)17-15-24)32(41)28(44-37(29)33(42)43)20-23-11-7-6-8-12-23/h6-8,11-12,14-17,22,26-29,38H,4-5,9-10,13,18-21H2,1-3H3,(H,34,39)(H,42,43)/t26-,27?,28?,29?/m0/s1 |
| InChIKey | HVWNNZGATNURSF-ADHPVOFISA-N |
| XLogP | 3.95 |
| TPSA | 139.72 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 44 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 608.74 |
| LogP ≤ 5 | 3.95 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|