C25H29N3O5 — CID 170356026
(3R,6S)-3,6-dibenzyl-8-(2-methylpropyl)-4,7-dioxo-9,9a-dihydro-6H-pyrazino[2,1-c][1,2,4]oxadiazine-1-carboxylic acid (PubChem CID 170356026) has the molecular formula C25H29N3O5 and a molecular weight of 451.52 g/mol. Its IUPAC name is (3R,6S)-3,6-dibenzyl-8-(2-methylpropyl)-4,7-dioxo-9,9a-dihydro-6H-pyrazino[2,1-c][1,2,4]oxadiazine-1-carboxylic acid.
| Compound Name | (3R,6S)-3,6-dibenzyl-8-(2-methylpropyl)-4,7-dioxo-9,9a-dihydro-6H-pyrazino[2,1-c][1,2,4]oxadiazine-1-carboxylic acid |
|---|---|
| PubChem CID | 170356026 |
| Molecular Formula | C25H29N3O5 |
| Molecular Weight | 451.52 g/mol |
| Exact Mass | 451.21 |
| IUPAC Name | (3R,6S)-3,6-dibenzyl-8-(2-methylpropyl)-4,7-dioxo-9,9a-dihydro-6H-pyrazino[2,1-c][1,2,4]oxadiazine-1-carboxylic acid |
| SMILES | CC(C)CN1CC2N(C(=O)O)O[C@H](Cc3ccccc3)C(=O)N2[C@@H](Cc2ccccc2)C1=O |
| InChI | InChI=1S/C25H29N3O5/c1-17(2)15-26-16-22-27(20(23(26)29)13-18-9-5-3-6-10-18)24(30)21(33-28(22)25(31)32)14-19-11-7-4-8-12-19/h3-12,17,20-22H,13-16H2,1-2H3,(H,31,32)/t20-,21+,22?/m0/s1 |
| InChIKey | WUTNTWCWGCNHCW-UGGDCYSXSA-N |
| XLogP | 2.79 |
| TPSA | 90.39 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 451.52 |
| LogP ≤ 5 | 2.79 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |