C30H46N4O5 — CID 170355944
cyclohexylmethyl (3S,6S,9aS)-6-(4-aminobutyl)-3-(2-methylpropyl)-4,7-dioxo-8-(2-phenylethyl)-9,9a-dihydro-6H-pyrazino[2,1-c][1,2,4]oxadiazine-1-carboxylate (PubChem CID 170355944) has the molecular formula C30H46N4O5 and a molecular weight of 542.72 g/mol. Its IUPAC name is cyclohexylmethyl (3S,6S,9aS)-6-(4-aminobutyl)-3-(2-methylpropyl)-4,7-dioxo-8-(2-phenylethyl)-9,9a-dihydro-6H-pyrazino[2,1-c][1,2,4]oxadiazine-1-carboxylate.
| Compound Name | cyclohexylmethyl (3S,6S,9aS)-6-(4-aminobutyl)-3-(2-methylpropyl)-4,7-dioxo-8-(2-phenylethyl)-9,9a-dihydro-6H-pyrazino[2,1-c][1,2,4]oxadiazine-1-carboxylate |
|---|---|
| PubChem CID | 170355944 |
| Molecular Formula | C30H46N4O5 |
| Molecular Weight | 542.72 g/mol |
| Exact Mass | 542.35 |
| IUPAC Name | cyclohexylmethyl (3S,6S,9aS)-6-(4-aminobutyl)-3-(2-methylpropyl)-4,7-dioxo-8-(2-phenylethyl)-9,9a-dihydro-6H-pyrazino[2,1-c][1,2,4]oxadiazine-1-carboxylate |
| SMILES | CC(C)C[C@@H]1ON(C(=O)OCC2CCCCC2)[C@H]2CN(CCc3ccccc3)C(=O)[C@H](CCCCN)N2C1=O |
| InChI | InChI=1S/C30H46N4O5/c1-22(2)19-26-29(36)33-25(15-9-10-17-31)28(35)32(18-16-23-11-5-3-6-12-23)20-27(33)34(39-26)30(37)38-21-24-13-7-4-8-14-24/h3,5-6,11-12,22,24-27H,4,7-10,13-21,31H2,1-2H3/t25-,26-,27-/m0/s1 |
| InChIKey | CRGLPWHYJZMAHF-QKDODKLFSA-N |
| XLogP | 4.10 |
| TPSA | 105.41 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 39 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 542.72 |
| LogP ≤ 5 | 4.10 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|