C28H42N4O5 — CID 169028986
benzyl (3R,6S,9aS)-6-(2,2-dimethylpropyl)-3-(2-methylpropyl)-4,7-dioxo-8-piperidin-4-yl-9,9a-dihydro-6H-pyrazino[2,1-c][1,2,4]oxadiazine-1-carboxylate (PubChem CID 169028986) has the molecular formula C28H42N4O5 and a molecular weight of 514.67 g/mol. Its IUPAC name is benzyl (3R,6S,9aS)-6-(2,2-dimethylpropyl)-3-(2-methylpropyl)-4,7-dioxo-8-piperidin-4-yl-9,9a-dihydro-6H-pyrazino[2,1-c][1,2,4]oxadiazine-1-carboxylate.
| Compound Name | benzyl (3R,6S,9aS)-6-(2,2-dimethylpropyl)-3-(2-methylpropyl)-4,7-dioxo-8-piperidin-4-yl-9,9a-dihydro-6H-pyrazino[2,1-c][1,2,4]oxadiazine-1-carboxylate |
|---|---|
| PubChem CID | 169028986 |
| Molecular Formula | C28H42N4O5 |
| Molecular Weight | 514.67 g/mol |
| Exact Mass | 514.32 |
| IUPAC Name | benzyl (3R,6S,9aS)-6-(2,2-dimethylpropyl)-3-(2-methylpropyl)-4,7-dioxo-8-piperidin-4-yl-9,9a-dihydro-6H-pyrazino[2,1-c][1,2,4]oxadiazine-1-carboxylate |
| SMILES | CC(C)C[C@H]1ON(C(=O)OCc2ccccc2)[C@H]2CN(C3CCNCC3)C(=O)[C@H](CC(C)(C)C)N2C1=O |
| InChI | InChI=1S/C28H42N4O5/c1-19(2)15-23-26(34)31-22(16-28(3,4)5)25(33)30(21-11-13-29-14-12-21)17-24(31)32(37-23)27(35)36-18-20-9-7-6-8-10-20/h6-10,19,21-24,29H,11-18H2,1-5H3/t22-,23+,24-/m0/s1 |
| InChIKey | XMFAYDONGQENMF-VXNXHJTFSA-N |
| XLogP | 3.54 |
| TPSA | 91.42 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 37 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 514.67 |
| LogP ≤ 5 | 3.54 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |