C25H39N3O4 — CID 166630080
2-methylpropyl (3R,6S,9aS)-8-benzyl-6-(2-methylpropyl)-4-oxo-3-propan-2-yl-6,7,9,9a-tetrahydropyrazino[2,1-c][1,2,4]oxadiazine-1-carboxylate (PubChem CID 166630080) has the molecular formula C25H39N3O4 and a molecular weight of 445.60 g/mol. Its IUPAC name is 2-methylpropyl (3R,6S,9aS)-8-benzyl-6-(2-methylpropyl)-4-oxo-3-propan-2-yl-6,7,9,9a-tetrahydropyrazino[2,1-c][1,2,4]oxadiazine-1-carboxylate.
| Compound Name | 2-methylpropyl (3R,6S,9aS)-8-benzyl-6-(2-methylpropyl)-4-oxo-3-propan-2-yl-6,7,9,9a-tetrahydropyrazino[2,1-c][1,2,4]oxadiazine-1-carboxylate |
|---|---|
| PubChem CID | 166630080 |
| Molecular Formula | C25H39N3O4 |
| Molecular Weight | 445.60 g/mol |
| Exact Mass | 445.29 |
| IUPAC Name | 2-methylpropyl (3R,6S,9aS)-8-benzyl-6-(2-methylpropyl)-4-oxo-3-propan-2-yl-6,7,9,9a-tetrahydropyrazino[2,1-c][1,2,4]oxadiazine-1-carboxylate |
| SMILES | CC(C)COC(=O)N1O[C@H](C(C)C)C(=O)N2[C@@H](CC(C)C)CN(Cc3ccccc3)C[C@H]12 |
| InChI | InChI=1S/C25H39N3O4/c1-17(2)12-21-14-26(13-20-10-8-7-9-11-20)15-22-27(21)24(29)23(19(5)6)32-28(22)25(30)31-16-18(3)4/h7-11,17-19,21-23H,12-16H2,1-6H3/t21-,22-,23+/m0/s1 |
| InChIKey | TYUJURQMEJTEAR-RJGXRXQPSA-N |
| XLogP | 4.14 |
| TPSA | 62.32 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 445.60 |
| LogP ≤ 5 | 4.14 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |