C26H42N4O4 — CID 169029007
benzyl (3R,6S,9aS)-8-[3-(methylamino)propyl]-3,6-bis(2-methylpropyl)-4-oxo-6,7,9,9a-tetrahydropyrazino[2,1-c][1,2,4]oxadiazine-1-carboxylate (PubChem CID 169029007) has the molecular formula C26H42N4O4 and a molecular weight of 474.65 g/mol. Its IUPAC name is benzyl (3R,6S,9aS)-8-[3-(methylamino)propyl]-3,6-bis(2-methylpropyl)-4-oxo-6,7,9,9a-tetrahydropyrazino[2,1-c][1,2,4]oxadiazine-1-carboxylate.
| Compound Name | benzyl (3R,6S,9aS)-8-[3-(methylamino)propyl]-3,6-bis(2-methylpropyl)-4-oxo-6,7,9,9a-tetrahydropyrazino[2,1-c][1,2,4]oxadiazine-1-carboxylate |
|---|---|
| PubChem CID | 169029007 |
| Molecular Formula | C26H42N4O4 |
| Molecular Weight | 474.65 g/mol |
| Exact Mass | 474.32 |
| IUPAC Name | benzyl (3R,6S,9aS)-8-[3-(methylamino)propyl]-3,6-bis(2-methylpropyl)-4-oxo-6,7,9,9a-tetrahydropyrazino[2,1-c][1,2,4]oxadiazine-1-carboxylate |
| SMILES | CNCCCN1C[C@H](CC(C)C)N2C(=O)[C@@H](CC(C)C)ON(C(=O)OCc3ccccc3)[C@H]2C1 |
| InChI | InChI=1S/C26H42N4O4/c1-19(2)14-22-16-28(13-9-12-27-5)17-24-29(22)25(31)23(15-20(3)4)34-30(24)26(32)33-18-21-10-7-6-8-11-21/h6-8,10-11,19-20,22-24,27H,9,12-18H2,1-5H3/t22-,23+,24-/m0/s1 |
| InChIKey | XRAMYKCMDVZWRM-VXNXHJTFSA-N |
| XLogP | 3.48 |
| TPSA | 74.35 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 474.65 |
| LogP ≤ 5 | 3.48 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|