C38H50N6O5 — CID 167003990
benzyl (3R,6S)-8-(1-methylpiperidin-4-yl)-3-(2-methylpropyl)-4,7-dioxo-6-[4-(quinolin-2-ylmethylamino)butyl]-9,9a-dihydro-6H-pyrazino[2,1-c][1,2,4]oxadiazine-1-carboxylate (PubChem CID 167003990) has the molecular formula C38H50N6O5 and a molecular weight of 670.86 g/mol. Its IUPAC name is benzyl (3R,6S)-8-(1-methylpiperidin-4-yl)-3-(2-methylpropyl)-4,7-dioxo-6-[4-(quinolin-2-ylmethylamino)butyl]-9,9a-dihydro-6H-pyrazino[2,1-c][1,2,4]oxadiazine-1-carboxylate.
| Compound Name | benzyl (3R,6S)-8-(1-methylpiperidin-4-yl)-3-(2-methylpropyl)-4,7-dioxo-6-[4-(quinolin-2-ylmethylamino)butyl]-9,9a-dihydro-6H-pyrazino[2,1-c][1,2,4]oxadiazine-1-carboxylate |
|---|---|
| PubChem CID | 167003990 |
| Molecular Formula | C38H50N6O5 |
| Molecular Weight | 670.86 g/mol |
| Exact Mass | 670.38 |
| IUPAC Name | benzyl (3R,6S)-8-(1-methylpiperidin-4-yl)-3-(2-methylpropyl)-4,7-dioxo-6-[4-(quinolin-2-ylmethylamino)butyl]-9,9a-dihydro-6H-pyrazino[2,1-c][1,2,4]oxadiazine-1-carboxylate |
| SMILES | CC(C)C[C@H]1ON(C(=O)OCc2ccccc2)C2CN(C3CCN(C)CC3)C(=O)[C@H](CCCCNCc3ccc4ccccc4n3)N2C1=O |
| InChI | InChI=1S/C38H50N6O5/c1-27(2)23-34-37(46)43-33(15-9-10-20-39-24-30-17-16-29-13-7-8-14-32(29)40-30)36(45)42(31-18-21-41(3)22-19-31)25-35(43)44(49-34)38(47)48-26-28-11-5-4-6-12-28/h4-8,11-14,16-17,27,31,33-35,39H,9-10,15,18-26H2,1-3H3/t33-,34+,35?/m0/s1 |
| InChIKey | AAGAIQTUMDSUNM-GWDKEWMYSA-N |
| XLogP | 4.95 |
| TPSA | 107.55 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 49 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 670.86 |
| LogP ≤ 5 | 4.95 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|