C20H34N4O5 — CID 170355884
3,6-bis(2-methylpropyl)-4,7-dioxo-8-piperidin-4-yl-9,9a-dihydro-6H-pyrazino[2,1-c][1,2,4]oxadiazine-1-carboxylic acid (PubChem CID 170355884) has the molecular formula C20H34N4O5 and a molecular weight of 410.52 g/mol. Its IUPAC name is 3,6-bis(2-methylpropyl)-4,7-dioxo-8-piperidin-4-yl-9,9a-dihydro-6H-pyrazino[2,1-c][1,2,4]oxadiazine-1-carboxylic acid.
| Compound Name | 3,6-bis(2-methylpropyl)-4,7-dioxo-8-piperidin-4-yl-9,9a-dihydro-6H-pyrazino[2,1-c][1,2,4]oxadiazine-1-carboxylic acid |
|---|---|
| PubChem CID | 170355884 |
| Molecular Formula | C20H34N4O5 |
| Molecular Weight | 410.52 g/mol |
| Exact Mass | 410.25 |
| IUPAC Name | 3,6-bis(2-methylpropyl)-4,7-dioxo-8-piperidin-4-yl-9,9a-dihydro-6H-pyrazino[2,1-c][1,2,4]oxadiazine-1-carboxylic acid |
| SMILES | CC(C)CC1ON(C(=O)O)C2CN(C3CCNCC3)C(=O)C(CC(C)C)N2C1=O |
| InChI | InChI=1S/C20H34N4O5/c1-12(2)9-15-18(25)22(14-5-7-21-8-6-14)11-17-23(15)19(26)16(10-13(3)4)29-24(17)20(27)28/h12-17,21H,5-11H2,1-4H3,(H,27,28) |
| InChIKey | IOXPEDSIECQORT-UHFFFAOYSA-N |
| XLogP | 1.49 |
| TPSA | 102.42 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 410.52 |
| LogP ≤ 5 | 1.49 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |