C22H39N4O7P — CID 170122113
3-[(3R,6S,9aS)-1-[2-[ethoxy(methyl)phosphoryl]acetyl]-3,6-bis(2-methylpropyl)-4,7-dioxo-9,9a-dihydro-6H-pyrazino[2,1-c][1,2,4]oxadiazin-8-yl]propanamide (PubChem CID 170122113) has the molecular formula C22H39N4O7P and a molecular weight of 502.55 g/mol. Its IUPAC name is 3-[(3R,6S,9aS)-1-[2-[ethoxy(methyl)phosphoryl]acetyl]-3,6-bis(2-methylpropyl)-4,7-dioxo-9,9a-dihydro-6H-pyrazino[2,1-c][1,2,4]oxadiazin-8-yl]propanamide.
| Compound Name | 3-[(3R,6S,9aS)-1-[2-[ethoxy(methyl)phosphoryl]acetyl]-3,6-bis(2-methylpropyl)-4,7-dioxo-9,9a-dihydro-6H-pyrazino[2,1-c][1,2,4]oxadiazin-8-yl]propanamide |
|---|---|
| PubChem CID | 170122113 |
| Molecular Formula | C22H39N4O7P |
| Molecular Weight | 502.55 g/mol |
| Exact Mass | 502.26 |
| IUPAC Name | 3-[(3R,6S,9aS)-1-[2-[ethoxy(methyl)phosphoryl]acetyl]-3,6-bis(2-methylpropyl)-4,7-dioxo-9,9a-dihydro-6H-pyrazino[2,1-c][1,2,4]oxadiazin-8-yl]propanamide |
| SMILES | CCOP(C)(=O)CC(=O)N1O[C@H](CC(C)C)C(=O)N2[C@@H]1CN(CCC(N)=O)C(=O)[C@@H]2CC(C)C |
| InChI | InChI=1S/C22H39N4O7P/c1-7-32-34(6,31)13-20(28)26-19-12-24(9-8-18(23)27)21(29)16(10-14(2)3)25(19)22(30)17(33-26)11-15(4)5/h14-17,19H,7-13H2,1-6H3,(H2,23,27)/t16-,17+,19-,34?/m0/s1 |
| InChIKey | BKDBIAQGRLSJMK-MUPGVETISA-N |
| XLogP | 1.41 |
| TPSA | 139.55 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 34 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 502.55 |
| LogP ≤ 5 | 1.41 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|