C25H45N4O9PS — CID 170123031
(3R,6S,9aS)-1-(2-diethoxyphosphorylacetyl)-8-(1-methylpiperidin-4-yl)-3-(2-methylpropyl)-6-(2-methylsulfonylethyl)-9,9a-dihydro-6H-pyrazino[2,1-c][1,2,4]oxadiazine-4,7-dione (PubChem CID 170123031) has the molecular formula C25H45N4O9PS and a molecular weight of 608.70 g/mol. Its IUPAC name is (3R,6S,9aS)-1-(2-diethoxyphosphorylacetyl)-8-(1-methylpiperidin-4-yl)-3-(2-methylpropyl)-6-(2-methylsulfonylethyl)-9,9a-dihydro-6H-pyrazino[2,1-c][1,2,4]oxadiazine-4,7-dione.
| Compound Name | (3R,6S,9aS)-1-(2-diethoxyphosphorylacetyl)-8-(1-methylpiperidin-4-yl)-3-(2-methylpropyl)-6-(2-methylsulfonylethyl)-9,9a-dihydro-6H-pyrazino[2,1-c][1,2,4]oxadiazine-4,7-dione |
|---|---|
| PubChem CID | 170123031 |
| Molecular Formula | C25H45N4O9PS |
| Molecular Weight | 608.70 g/mol |
| Exact Mass | 608.26 |
| IUPAC Name | (3R,6S,9aS)-1-(2-diethoxyphosphorylacetyl)-8-(1-methylpiperidin-4-yl)-3-(2-methylpropyl)-6-(2-methylsulfonylethyl)-9,9a-dihydro-6H-pyrazino[2,1-c][1,2,4]oxadiazine-4,7-dione |
| SMILES | CCOP(=O)(CC(=O)N1O[C@H](CC(C)C)C(=O)N2[C@@H]1CN(C1CCN(C)CC1)C(=O)[C@@H]2CCS(C)(=O)=O)OCC |
| InChI | InChI=1S/C25H45N4O9PS/c1-7-36-39(33,37-8-2)17-23(30)29-22-16-27(19-9-12-26(5)13-10-19)24(31)20(11-14-40(6,34)35)28(22)25(32)21(38-29)15-18(3)4/h18-22H,7-17H2,1-6H3/t20-,21+,22-/m0/s1 |
| InChIKey | TXFSEOVSEQUGSL-BDTNDASRSA-N |
| XLogP | 1.34 |
| TPSA | 143.07 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 40 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 608.70 |
| LogP ≤ 5 | 1.34 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|