C20H36N4O3 — CID 170122947
(3R,6S,9aS)-8-(1-methylpiperidin-4-yl)-3,6-bis(2-methylpropyl)-1,6,9,9a-tetrahydropyrazino[2,1-c][1,2,4]oxadiazine-4,7-dione (PubChem CID 170122947) has the molecular formula C20H36N4O3 and a molecular weight of 380.53 g/mol. Its IUPAC name is (3R,6S,9aS)-8-(1-methylpiperidin-4-yl)-3,6-bis(2-methylpropyl)-1,6,9,9a-tetrahydropyrazino[2,1-c][1,2,4]oxadiazine-4,7-dione.
| Compound Name | (3R,6S,9aS)-8-(1-methylpiperidin-4-yl)-3,6-bis(2-methylpropyl)-1,6,9,9a-tetrahydropyrazino[2,1-c][1,2,4]oxadiazine-4,7-dione |
|---|---|
| PubChem CID | 170122947 |
| Molecular Formula | C20H36N4O3 |
| Molecular Weight | 380.53 g/mol |
| Exact Mass | 380.28 |
| IUPAC Name | (3R,6S,9aS)-8-(1-methylpiperidin-4-yl)-3,6-bis(2-methylpropyl)-1,6,9,9a-tetrahydropyrazino[2,1-c][1,2,4]oxadiazine-4,7-dione |
| SMILES | CC(C)C[C@H]1ON[C@H]2CN(C3CCN(C)CC3)C(=O)[C@H](CC(C)C)N2C1=O |
| InChI | InChI=1S/C20H36N4O3/c1-13(2)10-16-19(25)23(15-6-8-22(5)9-7-15)12-18-21-27-17(11-14(3)4)20(26)24(16)18/h13-18,21H,6-12H2,1-5H3/t16-,17+,18+/m0/s1 |
| InChIKey | UOTVGZLWPJMZLM-RCCFBDPRSA-N |
| XLogP | 1.44 |
| TPSA | 65.12 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 380.53 |
| LogP ≤ 5 | 1.44 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |