C34H47N5O5 — CID 163518733
[(3R,6S)-6-[4-(benzylamino)butyl]-8-(1-methylpiperidin-4-yl)-3-(2-methylpropyl)-4,7-dioxo-9,9a-dihydro-6H-pyrazino[2,1-c][1,2,4]oxadiazin-1-yl] benzoate (PubChem CID 163518733) has the molecular formula C34H47N5O5 and a molecular weight of 605.78 g/mol. Its IUPAC name is [(3R,6S)-6-[4-(benzylamino)butyl]-8-(1-methylpiperidin-4-yl)-3-(2-methylpropyl)-4,7-dioxo-9,9a-dihydro-6H-pyrazino[2,1-c][1,2,4]oxadiazin-1-yl] benzoate.
| Compound Name | [(3R,6S)-6-[4-(benzylamino)butyl]-8-(1-methylpiperidin-4-yl)-3-(2-methylpropyl)-4,7-dioxo-9,9a-dihydro-6H-pyrazino[2,1-c][1,2,4]oxadiazin-1-yl] benzoate |
|---|---|
| PubChem CID | 163518733 |
| Molecular Formula | C34H47N5O5 |
| Molecular Weight | 605.78 g/mol |
| Exact Mass | 605.36 |
| IUPAC Name | [(3R,6S)-6-[4-(benzylamino)butyl]-8-(1-methylpiperidin-4-yl)-3-(2-methylpropyl)-4,7-dioxo-9,9a-dihydro-6H-pyrazino[2,1-c][1,2,4]oxadiazin-1-yl] benzoate |
| SMILES | CC(C)C[C@H]1ON(OC(=O)c2ccccc2)C2CN(C3CCN(C)CC3)C(=O)[C@H](CCCCNCc3ccccc3)N2C1=O |
| InChI | InChI=1S/C34H47N5O5/c1-25(2)22-30-33(41)38-29(16-10-11-19-35-23-26-12-6-4-7-13-26)32(40)37(28-17-20-36(3)21-18-28)24-31(38)39(43-30)44-34(42)27-14-8-5-9-15-27/h4-9,12-15,25,28-31,35H,10-11,16-24H2,1-3H3/t29-,30+,31?/m0/s1 |
| InChIKey | DIYYLROFINXABH-RLZXXUCQSA-N |
| XLogP | 3.84 |
| TPSA | 94.66 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 44 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 605.78 |
| LogP ≤ 5 | 3.84 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|