C25H38N4O4 — CID 171564315
(2R,5S)-1-(furan-2-carbonyl)-2,5-bis(2-methylpropyl)-7-(piperidin-4-ylmethyl)-2,5,8,8a-tetrahydroimidazo[1,2-a]pyrazine-3,6-dione (PubChem CID 171564315) has the molecular formula C25H38N4O4 and a molecular weight of 458.60 g/mol. Its IUPAC name is (2R,5S)-1-(furan-2-carbonyl)-2,5-bis(2-methylpropyl)-7-(piperidin-4-ylmethyl)-2,5,8,8a-tetrahydroimidazo[1,2-a]pyrazine-3,6-dione.
| Compound Name | (2R,5S)-1-(furan-2-carbonyl)-2,5-bis(2-methylpropyl)-7-(piperidin-4-ylmethyl)-2,5,8,8a-tetrahydroimidazo[1,2-a]pyrazine-3,6-dione |
|---|---|
| PubChem CID | 171564315 |
| Molecular Formula | C25H38N4O4 |
| Molecular Weight | 458.60 g/mol |
| Exact Mass | 458.29 |
| IUPAC Name | (2R,5S)-1-(furan-2-carbonyl)-2,5-bis(2-methylpropyl)-7-(piperidin-4-ylmethyl)-2,5,8,8a-tetrahydroimidazo[1,2-a]pyrazine-3,6-dione |
| SMILES | CC(C)C[C@@H]1C(=O)N2C(CN(CC3CCNCC3)C(=O)[C@@H]2CC(C)C)N1C(=O)c1ccco1 |
| InChI | InChI=1S/C25H38N4O4/c1-16(2)12-19-23(30)27(14-18-7-9-26-10-8-18)15-22-28(19)24(31)20(13-17(3)4)29(22)25(32)21-6-5-11-33-21/h5-6,11,16-20,22,26H,7-10,12-15H2,1-4H3/t19-,20+,22?/m0/s1 |
| InChIKey | QSYZRFCJRJVGRB-RJKSWSIASA-N |
| XLogP | 2.56 |
| TPSA | 86.10 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 458.60 |
| LogP ≤ 5 | 2.56 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |