C26H44N4O5 — CID 170355808
methyl (3S,6S,9aS)-6-(4-aminobutyl)-3,8-bis(cyclohexylmethyl)-4,7-dioxo-9,9a-dihydro-6H-pyrazino[2,1-c][1,2,4]oxadiazine-1-carboxylate (PubChem CID 170355808) has the molecular formula C26H44N4O5 and a molecular weight of 492.66 g/mol. Its IUPAC name is methyl (3S,6S,9aS)-6-(4-aminobutyl)-3,8-bis(cyclohexylmethyl)-4,7-dioxo-9,9a-dihydro-6H-pyrazino[2,1-c][1,2,4]oxadiazine-1-carboxylate.
| Compound Name | methyl (3S,6S,9aS)-6-(4-aminobutyl)-3,8-bis(cyclohexylmethyl)-4,7-dioxo-9,9a-dihydro-6H-pyrazino[2,1-c][1,2,4]oxadiazine-1-carboxylate |
|---|---|
| PubChem CID | 170355808 |
| Molecular Formula | C26H44N4O5 |
| Molecular Weight | 492.66 g/mol |
| Exact Mass | 492.33 |
| IUPAC Name | methyl (3S,6S,9aS)-6-(4-aminobutyl)-3,8-bis(cyclohexylmethyl)-4,7-dioxo-9,9a-dihydro-6H-pyrazino[2,1-c][1,2,4]oxadiazine-1-carboxylate |
| SMILES | COC(=O)N1O[C@@H](CC2CCCCC2)C(=O)N2[C@@H]1CN(CC1CCCCC1)C(=O)[C@@H]2CCCCN |
| InChI | InChI=1S/C26H44N4O5/c1-34-26(33)30-23-18-28(17-20-12-6-3-7-13-20)24(31)21(14-8-9-15-27)29(23)25(32)22(35-30)16-19-10-4-2-5-11-19/h19-23H,2-18,27H2,1H3/t21-,22-,23-/m0/s1 |
| InChIKey | UCBKXVHQNNPAAP-VABKMULXSA-N |
| XLogP | 3.41 |
| TPSA | 105.41 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 35 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 492.66 |
| LogP ≤ 5 | 3.41 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|