C15H34BN3O3 — CID 164549422
2,6-diamino-N-(cyclohexylmethyl)hexanamide;ethylboronic acid (PubChem CID 164549422) has the molecular formula C15H34BN3O3 and a molecular weight of 315.27 g/mol. Its IUPAC name is 2,6-diamino-N-(cyclohexylmethyl)hexanamide;ethylboronic acid.
| Compound Name | 2,6-diamino-N-(cyclohexylmethyl)hexanamide;ethylboronic acid |
|---|---|
| PubChem CID | 164549422 |
| Molecular Formula | C15H34BN3O3 |
| Molecular Weight | 315.27 g/mol |
| Exact Mass | 315.27 |
| IUPAC Name | 2,6-diamino-N-(cyclohexylmethyl)hexanamide;ethylboronic acid |
| SMILES | CCB(O)O.NCCCCC(N)C(=O)NCC1CCCCC1 |
| InChI | InChI=1S/C13H27N3O.C2H7BO2/c14-9-5-4-8-12(15)13(17)16-10-11-6-2-1-3-7-11;1-2-3(4)5/h11-12H,1-10,14-15H2,(H,16,17);4-5H,2H2,1H3 |
| InChIKey | WCQWONIJGFAWSE-UHFFFAOYSA-N |
| XLogP | 0.62 |
| TPSA | 121.60 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 315.27 |
| LogP ≤ 5 | 0.62 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|