C26H30ClN3O6S — CID 20688953
2-[1-(4-chlorophenyl)sulfonyl-5-[(4-methylphenyl)methyl]-7-(2-methylpropyl)-3,6-dioxo-2,5,8,8a-tetrahydroimidazo[1,2-a]pyrazin-2-yl]acetic acid (PubChem CID 20688953) has the molecular formula C26H30ClN3O6S and a molecular weight of 548.06 g/mol. Its IUPAC name is 2-[1-(4-chlorophenyl)sulfonyl-5-[(4-methylphenyl)methyl]-7-(2-methylpropyl)-3,6-dioxo-2,5,8,8a-tetrahydroimidazo[1,2-a]pyrazin-2-yl]acetic acid.
| Compound Name | 2-[1-(4-chlorophenyl)sulfonyl-5-[(4-methylphenyl)methyl]-7-(2-methylpropyl)-3,6-dioxo-2,5,8,8a-tetrahydroimidazo[1,2-a]pyrazin-2-yl]acetic acid |
|---|---|
| PubChem CID | 20688953 |
| Molecular Formula | C26H30ClN3O6S |
| Molecular Weight | 548.06 g/mol |
| Exact Mass | 547.15 |
| IUPAC Name | 2-[1-(4-chlorophenyl)sulfonyl-5-[(4-methylphenyl)methyl]-7-(2-methylpropyl)-3,6-dioxo-2,5,8,8a-tetrahydroimidazo[1,2-a]pyrazin-2-yl]acetic acid |
| SMILES | Cc1ccc(CC2C(=O)N(CC(C)C)CC3N2C(=O)C(CC(=O)O)N3S(=O)(=O)c2ccc(Cl)cc2)cc1 |
| InChI | InChI=1S/C26H30ClN3O6S/c1-16(2)14-28-15-23-29(21(25(28)33)12-18-6-4-17(3)5-7-18)26(34)22(13-24(31)32)30(23)37(35,36)20-10-8-19(27)9-11-20/h4-11,16,21-23H,12-15H2,1-3H3,(H,31,32) |
| InChIKey | MDWLCVORYRDQTB-UHFFFAOYSA-N |
| XLogP | 2.76 |
| TPSA | 115.30 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 37 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 548.06 |
| LogP ≤ 5 | 2.76 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |