C26H28ClN3O7S — CID 59894501
3-[(2S,5S,8aS)-5-benzyl-1-(4-chlorophenyl)sulfonyl-7-(3-hydroxybut-3-enyl)-3,6-dioxo-2,5,8,8a-tetrahydroimidazo[1,2-a]pyrazin-2-yl]propanoic acid (PubChem CID 59894501) has the molecular formula C26H28ClN3O7S and a molecular weight of 562.04 g/mol. Its IUPAC name is 3-[(2S,5S,8aS)-5-benzyl-1-(4-chlorophenyl)sulfonyl-7-(3-hydroxybut-3-enyl)-3,6-dioxo-2,5,8,8a-tetrahydroimidazo[1,2-a]pyrazin-2-yl]propanoic acid.
| Compound Name | 3-[(2S,5S,8aS)-5-benzyl-1-(4-chlorophenyl)sulfonyl-7-(3-hydroxybut-3-enyl)-3,6-dioxo-2,5,8,8a-tetrahydroimidazo[1,2-a]pyrazin-2-yl]propanoic acid |
|---|---|
| PubChem CID | 59894501 |
| Molecular Formula | C26H28ClN3O7S |
| Molecular Weight | 562.04 g/mol |
| Exact Mass | 561.13 |
| IUPAC Name | 3-[(2S,5S,8aS)-5-benzyl-1-(4-chlorophenyl)sulfonyl-7-(3-hydroxybut-3-enyl)-3,6-dioxo-2,5,8,8a-tetrahydroimidazo[1,2-a]pyrazin-2-yl]propanoic acid |
| SMILES | C=C(O)CCN1C[C@H]2N(C(=O)[C@H](CCC(=O)O)N2S(=O)(=O)c2ccc(Cl)cc2)[C@@H](Cc2ccccc2)C1=O |
| InChI | InChI=1S/C26H28ClN3O7S/c1-17(31)13-14-28-16-23-29(22(25(28)34)15-18-5-3-2-4-6-18)26(35)21(11-12-24(32)33)30(23)38(36,37)20-9-7-19(27)8-10-20/h2-10,21-23,31H,1,11-16H2,(H,32,33)/t21-,22-,23-/m0/s1 |
| InChIKey | HPVWAIMAJFKILL-VABKMULXSA-N |
| XLogP | 2.65 |
| TPSA | 135.53 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 38 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 562.04 |
| LogP ≤ 5 | 2.65 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'} |
|---|