C10H16N2O — CID 170356920
(3S)-3-(hydroxymethyl)-1,2,3,5,6,7,8,8a-octahydroindolizine-7-carbonitrile (PubChem CID 170356920) has the molecular formula C10H16N2O and a molecular weight of 180.25 g/mol. Its IUPAC name is (3S)-3-(hydroxymethyl)-1,2,3,5,6,7,8,8a-octahydroindolizine-7-carbonitrile.
| Compound Name | (3S)-3-(hydroxymethyl)-1,2,3,5,6,7,8,8a-octahydroindolizine-7-carbonitrile |
|---|---|
| PubChem CID | 170356920 |
| Molecular Formula | C10H16N2O |
| Molecular Weight | 180.25 g/mol |
| Exact Mass | 180.13 |
| IUPAC Name | (3S)-3-(hydroxymethyl)-1,2,3,5,6,7,8,8a-octahydroindolizine-7-carbonitrile |
| SMILES | N#CC1CCN2C(CC[C@H]2CO)C1 |
| InChI | InChI=1S/C10H16N2O/c11-6-8-3-4-12-9(5-8)1-2-10(12)7-13/h8-10,13H,1-5,7H2/t8?,9?,10-/m0/s1 |
| InChIKey | QMUQQYHEEDJWRL-RTBKNWGFSA-N |
| XLogP | 0.75 |
| TPSA | 47.26 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 180.25 |
| LogP ≤ 5 | 0.75 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |