C12H27NO2 — CID 177330814
[(6R)-3,4,6,7,8,8a-hexahydro-1H-pyrrolo[2,1-c][1,4]oxazin-6-yl]methanol;ethane (PubChem CID 177330814) has the molecular formula C12H27NO2 and a molecular weight of 217.35 g/mol. Its IUPAC name is [(6R)-3,4,6,7,8,8a-hexahydro-1H-pyrrolo[2,1-c][1,4]oxazin-6-yl]methanol;ethane.
| Compound Name | [(6R)-3,4,6,7,8,8a-hexahydro-1H-pyrrolo[2,1-c][1,4]oxazin-6-yl]methanol;ethane |
|---|---|
| PubChem CID | 177330814 |
| Molecular Formula | C12H27NO2 |
| Molecular Weight | 217.35 g/mol |
| Exact Mass | 217.20 |
| IUPAC Name | [(6R)-3,4,6,7,8,8a-hexahydro-1H-pyrrolo[2,1-c][1,4]oxazin-6-yl]methanol;ethane |
| SMILES | CC.CC.OC[C@H]1CCC2COCCN21 |
| InChI | InChI=1S/C8H15NO2.2C2H6/c10-5-7-1-2-8-6-11-4-3-9(7)8;2*1-2/h7-8,10H,1-6H2;2*1-2H3/t7-,8?;;/m1../s1 |
| InChIKey | PXBHJOBAHVRIAY-HMOXCYTFSA-N |
| XLogP | 1.89 |
| TPSA | 32.70 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 217.35 |
| LogP ≤ 5 | 1.89 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |