C8H16NO2P — CID 170768487
3,4,6,7,8,8a-hexahydro-1H-pyrrolo[2,1-c][1,4]oxazin-6-ylmethoxyphosphane (PubChem CID 170768487) has the molecular formula C8H16NO2P and a molecular weight of 189.19 g/mol. Its IUPAC name is 3,4,6,7,8,8a-hexahydro-1H-pyrrolo[2,1-c][1,4]oxazin-6-ylmethoxyphosphane.
| Compound Name | 3,4,6,7,8,8a-hexahydro-1H-pyrrolo[2,1-c][1,4]oxazin-6-ylmethoxyphosphane |
|---|---|
| PubChem CID | 170768487 |
| Molecular Formula | C8H16NO2P |
| Molecular Weight | 189.19 g/mol |
| Exact Mass | 189.09 |
| IUPAC Name | 3,4,6,7,8,8a-hexahydro-1H-pyrrolo[2,1-c][1,4]oxazin-6-ylmethoxyphosphane |
| SMILES | POCC1CCC2COCCN12 |
| InChI | InChI=1S/C8H16NO2P/c12-11-6-8-2-1-7-5-10-4-3-9(7)8/h7-8H,1-6,12H2 |
| InChIKey | QXXPBQDIFLNFDM-UHFFFAOYSA-N |
| XLogP | 0.66 |
| TPSA | 21.70 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 12 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 189.19 |
| LogP ≤ 5 | 0.66 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|