C11H21NO — CID 156794987
6,8-dimethyl-3,4,6,7,8,9,10,10a-octahydro-1H-[1,4]oxazino[4,3-a]azepine (PubChem CID 156794987) has the molecular formula C11H21NO and a molecular weight of 183.29 g/mol. Its IUPAC name is 6,8-dimethyl-3,4,6,7,8,9,10,10a-octahydro-1H-[1,4]oxazino[4,3-a]azepine.
| Compound Name | 6,8-dimethyl-3,4,6,7,8,9,10,10a-octahydro-1H-[1,4]oxazino[4,3-a]azepine |
|---|---|
| PubChem CID | 156794987 |
| Molecular Formula | C11H21NO |
| Molecular Weight | 183.29 g/mol |
| Exact Mass | 183.16 |
| IUPAC Name | 6,8-dimethyl-3,4,6,7,8,9,10,10a-octahydro-1H-[1,4]oxazino[4,3-a]azepine |
| SMILES | CC1CCC2COCCN2C(C)C1 |
| InChI | InChI=1S/C11H21NO/c1-9-3-4-11-8-13-6-5-12(11)10(2)7-9/h9-11H,3-8H2,1-2H3 |
| InChIKey | VNBUXJMRQSYHIV-UHFFFAOYSA-N |
| XLogP | 1.90 |
| TPSA | 12.47 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 183.29 |
| LogP ≤ 5 | 1.90 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |