C9H17NO2 — CID 177261927
(3S,4R)-3,4-dimethyl-3,4,6,7,9,9a-hexahydro-1H-[1,4]oxazino[3,4-c][1,4]oxazine (PubChem CID 177261927) has the molecular formula C9H17NO2 and a molecular weight of 171.24 g/mol. Its IUPAC name is (3S,4R)-3,4-dimethyl-3,4,6,7,9,9a-hexahydro-1H-[1,4]oxazino[3,4-c][1,4]oxazine.
| Compound Name | (3S,4R)-3,4-dimethyl-3,4,6,7,9,9a-hexahydro-1H-[1,4]oxazino[3,4-c][1,4]oxazine |
|---|---|
| PubChem CID | 177261927 |
| Molecular Formula | C9H17NO2 |
| Molecular Weight | 171.24 g/mol |
| Exact Mass | 171.13 |
| IUPAC Name | (3S,4R)-3,4-dimethyl-3,4,6,7,9,9a-hexahydro-1H-[1,4]oxazino[3,4-c][1,4]oxazine |
| SMILES | C[C@@H]1OCC2COCCN2[C@@H]1C |
| InChI | InChI=1S/C9H17NO2/c1-7-8(2)12-6-9-5-11-4-3-10(7)9/h7-9H,3-6H2,1-2H3/t7-,8+,9?/m1/s1 |
| InChIKey | PZOXNDKRDHYAAF-WGTSGOJVSA-N |
| XLogP | 0.49 |
| TPSA | 21.70 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | |
| Heavy Atoms | 12 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 171.24 |
| LogP ≤ 5 | 0.49 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |