C11H22N2O — CID 177261946
(6R,7R,10S,10aR)-6,7,10-trimethyl-3,4,6,7,8,9,10,10a-octahydro-1H-[1,4]oxazino[4,3-a][1,4]diazepine (PubChem CID 177261946) has the molecular formula C11H22N2O and a molecular weight of 198.31 g/mol. Its IUPAC name is (6R,7R,10S,10aR)-6,7,10-trimethyl-3,4,6,7,8,9,10,10a-octahydro-1H-[1,4]oxazino[4,3-a][1,4]diazepine.
| Compound Name | (6R,7R,10S,10aR)-6,7,10-trimethyl-3,4,6,7,8,9,10,10a-octahydro-1H-[1,4]oxazino[4,3-a][1,4]diazepine |
|---|---|
| PubChem CID | 177261946 |
| Molecular Formula | C11H22N2O |
| Molecular Weight | 198.31 g/mol |
| Exact Mass | 198.17 |
| IUPAC Name | (6R,7R,10S,10aR)-6,7,10-trimethyl-3,4,6,7,8,9,10,10a-octahydro-1H-[1,4]oxazino[4,3-a][1,4]diazepine |
| SMILES | C[C@@H]1CN[C@@H](C)[C@@H]2COCCN2[C@@H]1C |
| InChI | InChI=1S/C11H22N2O/c1-8-6-12-9(2)11-7-14-5-4-13(11)10(8)3/h8-12H,4-7H2,1-3H3/t8-,9+,10-,11+/m1/s1 |
| InChIKey | GSIPEAORASWGBN-YTWAJWBKSA-N |
| XLogP | 0.70 |
| TPSA | 24.50 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 198.31 |
| LogP ≤ 5 | 0.70 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |