C11H21NO2 — CID 177010102
(6S,8aS)-6-(propan-2-yloxymethyl)-3,4,6,7,8,8a-hexahydro-1H-pyrrolo[2,1-c][1,4]oxazine (PubChem CID 177010102) has the molecular formula C11H21NO2 and a molecular weight of 199.29 g/mol. Its IUPAC name is (6S,8aS)-6-(propan-2-yloxymethyl)-3,4,6,7,8,8a-hexahydro-1H-pyrrolo[2,1-c][1,4]oxazine.
| Compound Name | (6S,8aS)-6-(propan-2-yloxymethyl)-3,4,6,7,8,8a-hexahydro-1H-pyrrolo[2,1-c][1,4]oxazine |
|---|---|
| PubChem CID | 177010102 |
| Molecular Formula | C11H21NO2 |
| Molecular Weight | 199.29 g/mol |
| Exact Mass | 199.16 |
| IUPAC Name | (6S,8aS)-6-(propan-2-yloxymethyl)-3,4,6,7,8,8a-hexahydro-1H-pyrrolo[2,1-c][1,4]oxazine |
| SMILES | CC(C)OC[C@@H]1CC[C@H]2COCCN21 |
| InChI | InChI=1S/C11H21NO2/c1-9(2)14-8-11-4-3-10-7-13-6-5-12(10)11/h9-11H,3-8H2,1-2H3/t10-,11-/m0/s1 |
| InChIKey | HOPYVYRQKYHCTO-QWRGUYRKSA-N |
| XLogP | 1.27 |
| TPSA | 21.70 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 199.29 |
| LogP ≤ 5 | 1.27 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |