About 2-(benzhydrylideneamino)-4,4,4-trifluorobutanenitrile
2-(benzhydrylideneamino)-4,4,4-trifluorobutanenitrile (PubChem CID 170357738) has the molecular formula C17H13F3N2
and a molecular weight of 302.30 g/mol. Its IUPAC name is 2-(benzhydrylideneamino)-4,4,4-trifluorobutanenitrile.
Molecular Properties
| Compound Name | 2-(benzhydrylideneamino)-4,4,4-trifluorobutanenitrile |
| PubChem CID | 170357738 |
| Molecular Formula | C17H13F3N2 |
| Molecular Weight | 302.30 g/mol |
| Exact Mass | 302.10 |
| IUPAC Name | 2-(benzhydrylideneamino)-4,4,4-trifluorobutanenitrile |
| SMILES | N#CC(CC(F)(F)F)N=C(c1ccccc1)c1ccccc1 |
| InChI | InChI=1S/C17H13F3N2/c18-17(19,20)11-15(12-21)22-16(13-7-3-1-4-8-13)14-9-5-2-6-10-14/h1-10,15H,11H2 |
| InChIKey | TVXSDQKOPSZPJX-UHFFFAOYSA-N |
| XLogP | 4.37 |
| TPSA | 36.15 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 22 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 302.30 |
| LogP ≤ 5 | 4.37 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|
Analyze 2-(benzhydrylideneamino)-4,4,4-trifluorobutanenitrile with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-(benzhydrylideneamino)-4,4,4-trifluorobutanenitrile?
The IUPAC name of 2-(benzhydrylideneamino)-4,4,4-trifluorobutanenitrile (CID 170357738) is 2-(benzhydrylideneamino)-4,4,4-trifluorobutanenitrile.
What is the SMILES notation for 2-(benzhydrylideneamino)-4,4,4-trifluorobutanenitrile?
The canonical SMILES for 2-(benzhydrylideneamino)-4,4,4-trifluorobutanenitrile is N#CC(CC(F)(F)F)N=C(c1ccccc1)c1ccccc1.
What is the InChIKey of 2-(benzhydrylideneamino)-4,4,4-trifluorobutanenitrile?
The InChIKey is TVXSDQKOPSZPJX-UHFFFAOYSA-N. The full InChI is InChI=1S/C17H13F3N2/c18-17(19,20)11-15(12-21)22-16(13-7-3-1-4-8-13)14-9-5-2-6-10-14/h1-10,15H,11H2.
What are the key properties of 2-(benzhydrylideneamino)-4,4,4-trifluorobutanenitrile?
2-(benzhydrylideneamino)-4,4,4-trifluorobutanenitrile has a molecular weight of 302.30 g/mol, XLogP of 4.37, 4 rotatable bonds, 0 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 2-(benzhydrylideneamino)-4,4,4-trifluorobutanenitrile is sourced from PubChem (CID 170357738), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).