C17H13F3N2 — CID 170357738
2-(benzhydrylideneamino)-4,4,4-trifluorobutanenitrile (PubChem CID 170357738) has the molecular formula C17H13F3N2 and a molecular weight of 302.30 g/mol. Its IUPAC name is 2-(benzhydrylideneamino)-4,4,4-trifluorobutanenitrile.
| Compound Name | 2-(benzhydrylideneamino)-4,4,4-trifluorobutanenitrile |
|---|---|
| PubChem CID | 170357738 |
| Molecular Formula | C17H13F3N2 |
| Molecular Weight | 302.30 g/mol |
| Exact Mass | 302.10 |
| IUPAC Name | 2-(benzhydrylideneamino)-4,4,4-trifluorobutanenitrile |
| SMILES | N#CC(CC(F)(F)F)N=C(c1ccccc1)c1ccccc1 |
| InChI | InChI=1S/C17H13F3N2/c18-17(19,20)11-15(12-21)22-16(13-7-3-1-4-8-13)14-9-5-2-6-10-14/h1-10,15H,11H2 |
| InChIKey | TVXSDQKOPSZPJX-UHFFFAOYSA-N |
| XLogP | 4.37 |
| TPSA | 36.15 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 302.30 |
| LogP ≤ 5 | 4.37 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|