C26H26FIN6O5S — CID 170359092
3-cyclopropyl-5-(2-fluoro-4-iodoanilino)-6,8-dimethyl-2,4,7-trioxo-1-[3-[2-(2-sulfinohydrazinyl)ethyl]phenyl]pyrido[4,3-d]pyrimidine (PubChem CID 170359092) has the molecular formula C26H26FIN6O5S and a molecular weight of 680.50 g/mol. Its IUPAC name is 3-cyclopropyl-5-(2-fluoro-4-iodoanilino)-6,8-dimethyl-2,4,7-trioxo-1-[3-[2-(2-sulfinohydrazinyl)ethyl]phenyl]pyrido[4,3-d]pyrimidine.
| Compound Name | 3-cyclopropyl-5-(2-fluoro-4-iodoanilino)-6,8-dimethyl-2,4,7-trioxo-1-[3-[2-(2-sulfinohydrazinyl)ethyl]phenyl]pyrido[4,3-d]pyrimidine |
|---|---|
| PubChem CID | 170359092 |
| Molecular Formula | C26H26FIN6O5S |
| Molecular Weight | 680.50 g/mol |
| Exact Mass | 680.07 |
| IUPAC Name | 3-cyclopropyl-5-(2-fluoro-4-iodoanilino)-6,8-dimethyl-2,4,7-trioxo-1-[3-[2-(2-sulfinohydrazinyl)ethyl]phenyl]pyrido[4,3-d]pyrimidine |
| SMILES | Cc1c(=O)n(C)c(Nc2ccc(I)cc2F)c2c(=O)n(C3CC3)c(=O)n(-c3cccc(CCNNS(=O)O)c3)c12 |
| InChI | InChI=1S/C26H26FIN6O5S/c1-14-22-21(23(32(2)24(14)35)30-20-9-6-16(28)13-19(20)27)25(36)34(17-7-8-17)26(37)33(22)18-5-3-4-15(12-18)10-11-29-31-40(38)39/h3-6,9,12-13,17,29-31H,7-8,10-11H2,1-2H3,(H,38,39) |
| InChIKey | UTYWTZDZFZXRHO-UHFFFAOYSA-N |
| XLogP | 2.76 |
| TPSA | 139.39 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 40 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 680.50 |
| LogP ≤ 5 | 2.76 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'sulfinic_acid', 'substructure': 'N/A'} |
|---|