C9H16N2O3S — CID 170359661
2-[(2-methylsulfanylacetyl)amino]-N-(3-oxobutyl)acetamide (PubChem CID 170359661) has the molecular formula C9H16N2O3S and a molecular weight of 232.30 g/mol. Its IUPAC name is 2-[(2-methylsulfanylacetyl)amino]-N-(3-oxobutyl)acetamide.
| Compound Name | 2-[(2-methylsulfanylacetyl)amino]-N-(3-oxobutyl)acetamide |
|---|---|
| PubChem CID | 170359661 |
| Molecular Formula | C9H16N2O3S |
| Molecular Weight | 232.30 g/mol |
| Exact Mass | 232.09 |
| IUPAC Name | 2-[(2-methylsulfanylacetyl)amino]-N-(3-oxobutyl)acetamide |
| SMILES | CSCC(=O)NCC(=O)NCCC(C)=O |
| InChI | InChI=1S/C9H16N2O3S/c1-7(12)3-4-10-8(13)5-11-9(14)6-15-2/h3-6H2,1-2H3,(H,10,13)(H,11,14) |
| InChIKey | FKSWBQFWHJRDIM-UHFFFAOYSA-N |
| XLogP | -0.44 |
| TPSA | 75.27 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 232.30 |
| LogP ≤ 5 | -0.44 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |